C26H16N4OS — CID 102462534
2-[5-[1-(4-methoxyphenyl)-5-phenylpyrrol-2-yl]thiophen-2-yl]ethene-1,1,2-tricarbonitrile (PubChem CID 102462534) has the molecular formula C26H16N4OS and a molecular weight of 432.51 g/mol. Its IUPAC name is 2-[5-[1-(4-methoxyphenyl)-5-phenylpyrrol-2-yl]thiophen-2-yl]ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-[5-[1-(4-methoxyphenyl)-5-phenylpyrrol-2-yl]thiophen-2-yl]ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 102462534 |
| Molecular Formula | C26H16N4OS |
| Molecular Weight | 432.51 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | 2-[5-[1-(4-methoxyphenyl)-5-phenylpyrrol-2-yl]thiophen-2-yl]ethene-1,1,2-tricarbonitrile |
| SMILES | COc1ccc(-n2c(-c3ccccc3)ccc2-c2ccc(C(C#N)=C(C#N)C#N)s2)cc1 |
| InChI | InChI=1S/C26H16N4OS/c1-31-21-9-7-20(8-10-21)30-23(18-5-3-2-4-6-18)11-12-24(30)26-14-13-25(32-26)22(17-29)19(15-27)16-28/h2-14H,1H3 |
| InChIKey | MYMFPLYOVFFSCS-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 85.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.51 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|