C24H18F6N2OS — CID 102084911
4-[3,3,4,4,5,5-hexafluoro-2-[5-(4-methoxyphenyl)-2-methylthiophen-3-yl]cyclopenten-1-yl]-1,5-dimethylpyrrole-2-carbonitrile (PubChem CID 102084911) has the molecular formula C24H18F6N2OS and a molecular weight of 496.48 g/mol. Its IUPAC name is 4-[3,3,4,4,5,5-hexafluoro-2-[5-(4-methoxyphenyl)-2-methylthiophen-3-yl]cyclopenten-1-yl]-1,5-dimethylpyrrole-2-carbonitrile.
| Compound Name | 4-[3,3,4,4,5,5-hexafluoro-2-[5-(4-methoxyphenyl)-2-methylthiophen-3-yl]cyclopenten-1-yl]-1,5-dimethylpyrrole-2-carbonitrile |
|---|---|
| PubChem CID | 102084911 |
| Molecular Formula | C24H18F6N2OS |
| Molecular Weight | 496.48 g/mol |
| Exact Mass | 496.10 |
| IUPAC Name | 4-[3,3,4,4,5,5-hexafluoro-2-[5-(4-methoxyphenyl)-2-methylthiophen-3-yl]cyclopenten-1-yl]-1,5-dimethylpyrrole-2-carbonitrile |
| SMILES | COc1ccc(-c2cc(C3=C(c4cc(C#N)n(C)c4C)C(F)(F)C(F)(F)C3(F)F)c(C)s2)cc1 |
| InChI | InChI=1S/C24H18F6N2OS/c1-12-17(9-15(11-31)32(12)3)20-21(23(27,28)24(29,30)22(20,25)26)18-10-19(34-13(18)2)14-5-7-16(33-4)8-6-14/h5-10H,1-4H3 |
| InChIKey | SFARYBNCGIDRFF-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 37.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.48 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|