C22H16F6N2OS — CID 72793434
4-[3,3,4,4,5,5-hexafluoro-2-(5-methoxy-1,2-dimethylindol-3-yl)cyclopenten-1-yl]-5-methylthiophene-2-carbonitrile (PubChem CID 72793434) has the molecular formula C22H16F6N2OS and a molecular weight of 470.44 g/mol. Its IUPAC name is 4-[3,3,4,4,5,5-hexafluoro-2-(5-methoxy-1,2-dimethylindol-3-yl)cyclopenten-1-yl]-5-methylthiophene-2-carbonitrile.
| Compound Name | 4-[3,3,4,4,5,5-hexafluoro-2-(5-methoxy-1,2-dimethylindol-3-yl)cyclopenten-1-yl]-5-methylthiophene-2-carbonitrile |
|---|---|
| PubChem CID | 72793434 |
| Molecular Formula | C22H16F6N2OS |
| Molecular Weight | 470.44 g/mol |
| Exact Mass | 470.09 |
| IUPAC Name | 4-[3,3,4,4,5,5-hexafluoro-2-(5-methoxy-1,2-dimethylindol-3-yl)cyclopenten-1-yl]-5-methylthiophene-2-carbonitrile |
| SMILES | COc1ccc2c(c1)c(C1=C(c3cc(C#N)sc3C)C(F)(F)C(F)(F)C1(F)F)c(C)n2C |
| InChI | InChI=1S/C22H16F6N2OS/c1-10-17(15-7-12(31-4)5-6-16(15)30(10)3)19-18(14-8-13(9-29)32-11(14)2)20(23,24)22(27,28)21(19,25)26/h5-8H,1-4H3 |
| InChIKey | COEXKFKUTQLQBZ-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 37.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.44 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|