C27H24F6N2O2 — CID 102531509
3-[3,3,4,4,5,5-hexafluoro-2-(5-methoxy-1,2-dimethylindol-3-yl)cyclopenten-1-yl]-5-methoxy-1,2-dimethylindole (PubChem CID 102531509) has the molecular formula C27H24F6N2O2 and a molecular weight of 522.49 g/mol. Its IUPAC name is 3-[3,3,4,4,5,5-hexafluoro-2-(5-methoxy-1,2-dimethylindol-3-yl)cyclopenten-1-yl]-5-methoxy-1,2-dimethylindole.
| Compound Name | 3-[3,3,4,4,5,5-hexafluoro-2-(5-methoxy-1,2-dimethylindol-3-yl)cyclopenten-1-yl]-5-methoxy-1,2-dimethylindole |
|---|---|
| PubChem CID | 102531509 |
| Molecular Formula | C27H24F6N2O2 |
| Molecular Weight | 522.49 g/mol |
| Exact Mass | 522.17 |
| IUPAC Name | 3-[3,3,4,4,5,5-hexafluoro-2-(5-methoxy-1,2-dimethylindol-3-yl)cyclopenten-1-yl]-5-methoxy-1,2-dimethylindole |
| SMILES | COc1ccc2c(c1)c(C1=C(c3c(C)n(C)c4ccc(OC)cc34)C(F)(F)C(F)(F)C1(F)F)c(C)n2C |
| InChI | InChI=1S/C27H24F6N2O2/c1-13-21(17-11-15(36-5)7-9-19(17)34(13)3)23-24(26(30,31)27(32,33)25(23,28)29)22-14(2)35(4)20-10-8-16(37-6)12-18(20)22/h7-12H,1-6H3 |
| InChIKey | HTUVSNUSVCZIRM-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 28.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.49 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|