C22H16F6N2OS — CID 87585328
4-[2-(1,2-dimethylindol-3-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-3-methoxy-5-methylthiophene-2-carbonitrile (PubChem CID 87585328) has the molecular formula C22H16F6N2OS and a molecular weight of 470.44 g/mol. Its IUPAC name is 4-[2-(1,2-dimethylindol-3-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-3-methoxy-5-methylthiophene-2-carbonitrile.
| Compound Name | 4-[2-(1,2-dimethylindol-3-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-3-methoxy-5-methylthiophene-2-carbonitrile |
|---|---|
| PubChem CID | 87585328 |
| Molecular Formula | C22H16F6N2OS |
| Molecular Weight | 470.44 g/mol |
| Exact Mass | 470.09 |
| IUPAC Name | 4-[2-(1,2-dimethylindol-3-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-3-methoxy-5-methylthiophene-2-carbonitrile |
| SMILES | COc1c(C#N)sc(C)c1C1=C(c2c(C)n(C)c3ccccc23)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C22H16F6N2OS/c1-10-15(12-7-5-6-8-13(12)30(10)3)17-18(21(25,26)22(27,28)20(17,23)24)16-11(2)32-14(9-29)19(16)31-4/h5-8H,1-4H3 |
| InChIKey | STBZQAFOZVRIAR-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 37.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.44 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|