C33H29F6NOS — CID 20776478
3-[2-[2,4-dimethyl-5-[(1E,3E)-4-(4-methylphenyl)buta-1,3-dienyl]thiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-methoxy-1,2-dimethylindole (PubChem CID 20776478) has the molecular formula C33H29F6NOS and a molecular weight of 601.66 g/mol. Its IUPAC name is 3-[2-[2,4-dimethyl-5-[(1E,3E)-4-(4-methylphenyl)buta-1,3-dienyl]thiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-methoxy-1,2-dimethylindole.
| Compound Name | 3-[2-[2,4-dimethyl-5-[(1E,3E)-4-(4-methylphenyl)buta-1,3-dienyl]thiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-methoxy-1,2-dimethylindole |
|---|---|
| PubChem CID | 20776478 |
| Molecular Formula | C33H29F6NOS |
| Molecular Weight | 601.66 g/mol |
| Exact Mass | 601.19 |
| IUPAC Name | 3-[2-[2,4-dimethyl-5-[(1E,3E)-4-(4-methylphenyl)buta-1,3-dienyl]thiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-methoxy-1,2-dimethylindole |
| SMILES | COc1ccc2c(c1)c(C1=C(c3c(C)sc(/C=C/C=C/c4ccc(C)cc4)c3C)C(F)(F)C(F)(F)C1(F)F)c(C)n2C |
| InChI | InChI=1S/C33H29F6NOS/c1-18-11-13-22(14-12-18)9-7-8-10-26-19(2)27(21(4)42-26)29-30(32(36,37)33(38,39)31(29,34)35)28-20(3)40(5)25-16-15-23(41-6)17-24(25)28/h7-17H,1-6H3/b9-7+,10-8+ |
| InChIKey | XAPUWAHDFMNCCU-FIFLTTCUSA-N |
| XLogP | 10.04 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.66 |
| LogP ≤ 5 | 10.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|