C18H17NO2 — CID 102463226
2-(4-methoxyphenyl)-5-[(3-methylphenyl)methyl]-1,3-oxazole (PubChem CID 102463226) has the molecular formula C18H17NO2 and a molecular weight of 279.34 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-5-[(3-methylphenyl)methyl]-1,3-oxazole.
| Compound Name | 2-(4-methoxyphenyl)-5-[(3-methylphenyl)methyl]-1,3-oxazole |
|---|---|
| PubChem CID | 102463226 |
| Molecular Formula | C18H17NO2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 2-(4-methoxyphenyl)-5-[(3-methylphenyl)methyl]-1,3-oxazole |
| SMILES | COc1ccc(-c2ncc(Cc3cccc(C)c3)o2)cc1 |
| InChI | InChI=1S/C18H17NO2/c1-13-4-3-5-14(10-13)11-17-12-19-18(21-17)15-6-8-16(20-2)9-7-15/h3-10,12H,11H2,1-2H3 |
| InChIKey | XMANVZBYPONGSH-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |