C20H26O — CID 102463347
(2E,4Z,6E,8E)-8-[(3aS)-3a-methyl-3,4,5,6-tetrahydro-2H-inden-1-ylidene]-3,7-dimethylocta-2,4,6-trienal (PubChem CID 102463347) has the molecular formula C20H26O and a molecular weight of 282.43 g/mol. Its IUPAC name is (2E,4Z,6E,8E)-8-[(3aS)-3a-methyl-3,4,5,6-tetrahydro-2H-inden-1-ylidene]-3,7-dimethylocta-2,4,6-trienal.
| Compound Name | (2E,4Z,6E,8E)-8-[(3aS)-3a-methyl-3,4,5,6-tetrahydro-2H-inden-1-ylidene]-3,7-dimethylocta-2,4,6-trienal |
|---|---|
| PubChem CID | 102463347 |
| Molecular Formula | C20H26O |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.20 |
| IUPAC Name | (2E,4Z,6E,8E)-8-[(3aS)-3a-methyl-3,4,5,6-tetrahydro-2H-inden-1-ylidene]-3,7-dimethylocta-2,4,6-trienal |
| SMILES | CC(/C=C\C=C(C)\C=C1/CC[C@]2(C)CCCC=C12)=C\C=O |
| InChI | InChI=1S/C20H26O/c1-16(11-14-21)7-6-8-17(2)15-18-10-13-20(3)12-5-4-9-19(18)20/h6-9,11,14-15H,4-5,10,12-13H2,1-3H3/b7-6-,16-11+,17-8+,18-15+/t20-/m0/s1 |
| InChIKey | AEFBBBJHRBPBND-FVPKJEINSA-N |
| XLogP | 5.47 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|