C21H29BrHgO5 — CID 102463828
CID 102463828 (PubChem CID 102463828) has the molecular formula C21H29BrHgO5 and a molecular weight of 641.95 g/mol.
| Compound Name | CID 102463828 |
|---|---|
| PubChem CID | 102463828 |
| Molecular Formula | C21H29BrHgO5 |
| Molecular Weight | 641.95 g/mol |
| Exact Mass | 642.09 |
| IUPAC Name | — |
| SMILES | [Br-].[CH2][C@@H](CO)[C@H]1O[C@H]([C@H](C)C(=O)[C@@H](C)OC(=O)c2ccccc2)CC[C@@H]1C.[Hg+] |
| InChI | InChI=1S/C21H29O5.BrH.Hg/c1-13-10-11-18(26-20(13)14(2)12-22)15(3)19(23)16(4)25-21(24)17-8-6-5-7-9-17;;/h5-9,13-16,18,20,22H,2,10-12H2,1,3-4H3;1H;/q;;+1/p-1/t13-,14-,15-,16+,18-,20-;;/m0../s1 |
| InChIKey | SZKUYPCNBYWNSC-WZVKINTQSA-M |
| XLogP | 0.06 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.95 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|