C37H48O5Si — CID 11307928
[(2R,4S)-4-[(2S,5S,6R)-6-[(2S)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-5-methyloxan-2-yl]-3-oxopentan-2-yl] benzoate (PubChem CID 11307928) has the molecular formula C37H48O5Si and a molecular weight of 600.87 g/mol. Its IUPAC name is [(2R,4S)-4-[(2S,5S,6R)-6-[(2S)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-5-methyloxan-2-yl]-3-oxopentan-2-yl] benzoate.
| Compound Name | [(2R,4S)-4-[(2S,5S,6R)-6-[(2S)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-5-methyloxan-2-yl]-3-oxopentan-2-yl] benzoate |
|---|---|
| PubChem CID | 11307928 |
| Molecular Formula | C37H48O5Si |
| Molecular Weight | 600.87 g/mol |
| Exact Mass | 600.33 |
| IUPAC Name | [(2R,4S)-4-[(2S,5S,6R)-6-[(2S)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-5-methyloxan-2-yl]-3-oxopentan-2-yl] benzoate |
| SMILES | C[C@H](C(=O)[C@@H](C)OC(=O)c1ccccc1)[C@@H]1CC[C@H](C)[C@H]([C@@H](C)CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O1 |
| InChI | InChI=1S/C37H48O5Si/c1-26-23-24-33(28(3)34(38)29(4)41-36(39)30-17-11-8-12-18-30)42-35(26)27(2)25-40-43(37(5,6)7,31-19-13-9-14-20-31)32-21-15-10-16-22-32/h8-22,26-29,33,35H,23-25H2,1-7H3/t26-,27-,28-,29+,33-,35+/m0/s1 |
| InChIKey | HYKWMSUYNVYXAN-REHHJGRFSA-N |
| XLogP | 6.83 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.87 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|