C35H42O5Si — CID 102367260
[(2R,3R)-4-[tert-butyl(diphenyl)silyl]oxy-3-methyl-1-[(1R)-3-methylcyclohex-2-en-1-yl]oxy-1-oxobutan-2-yl] benzoate (PubChem CID 102367260) has the molecular formula C35H42O5Si and a molecular weight of 570.80 g/mol. Its IUPAC name is [(2R,3R)-4-[tert-butyl(diphenyl)silyl]oxy-3-methyl-1-[(1R)-3-methylcyclohex-2-en-1-yl]oxy-1-oxobutan-2-yl] benzoate.
| Compound Name | [(2R,3R)-4-[tert-butyl(diphenyl)silyl]oxy-3-methyl-1-[(1R)-3-methylcyclohex-2-en-1-yl]oxy-1-oxobutan-2-yl] benzoate |
|---|---|
| PubChem CID | 102367260 |
| Molecular Formula | C35H42O5Si |
| Molecular Weight | 570.80 g/mol |
| Exact Mass | 570.28 |
| IUPAC Name | [(2R,3R)-4-[tert-butyl(diphenyl)silyl]oxy-3-methyl-1-[(1R)-3-methylcyclohex-2-en-1-yl]oxy-1-oxobutan-2-yl] benzoate |
| SMILES | CC1=C[C@H](OC(=O)[C@H](OC(=O)c2ccccc2)[C@H](C)CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CCC1 |
| InChI | InChI=1S/C35H42O5Si/c1-26-16-15-19-29(24-26)39-34(37)32(40-33(36)28-17-9-6-10-18-28)27(2)25-38-41(35(3,4)5,30-20-11-7-12-21-30)31-22-13-8-14-23-31/h6-14,17-18,20-24,27,29,32H,15-16,19,25H2,1-5H3/t27-,29-,32-/m1/s1 |
| InChIKey | OJBXFBHMKUESJC-VDUCXAMOSA-N |
| XLogP | 6.47 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.80 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|