C22H31NO6 — CID 102465851
(3S)-2-benzyl-3-[(4R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methoxy-3,6-dihydrooxazine (PubChem CID 102465851) has the molecular formula C22H31NO6 and a molecular weight of 405.49 g/mol. Its IUPAC name is (3S)-2-benzyl-3-[(4R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methoxy-3,6-dihydrooxazine.
| Compound Name | (3S)-2-benzyl-3-[(4R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methoxy-3,6-dihydrooxazine |
|---|---|
| PubChem CID | 102465851 |
| Molecular Formula | C22H31NO6 |
| Molecular Weight | 405.49 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | (3S)-2-benzyl-3-[(4R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methoxy-3,6-dihydrooxazine |
| SMILES | COC1=CCON(Cc2ccccc2)[C@H]1[C@H]1OC(C)(C)O[C@H]1[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C22H31NO6/c1-21(2)25-14-17(27-21)19-20(29-22(3,4)28-19)18-16(24-5)11-12-26-23(18)13-15-9-7-6-8-10-15/h6-11,17-20H,12-14H2,1-5H3/t17-,18-,19+,20-/m1/s1 |
| InChIKey | NAMGZJBHBUDIBQ-YSTOQKLRSA-N |
| XLogP | 3.00 |
| TPSA | 58.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.49 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |