C16H14N4O5 — CID 10246746
(E)-2-(5-ethoxycarbonyl-10-oxo-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-11-yl)but-2-enoic acid (PubChem CID 10246746) has the molecular formula C16H14N4O5 and a molecular weight of 342.31 g/mol. Its IUPAC name is (E)-2-(5-ethoxycarbonyl-10-oxo-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-11-yl)but-2-enoic acid.
| Compound Name | (E)-2-(5-ethoxycarbonyl-10-oxo-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-11-yl)but-2-enoic acid |
|---|---|
| PubChem CID | 10246746 |
| Molecular Formula | C16H14N4O5 |
| Molecular Weight | 342.31 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | (E)-2-(5-ethoxycarbonyl-10-oxo-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-11-yl)but-2-enoic acid |
| SMILES | C/C=C(\C(=O)O)n1ccc2c(cnc3c(C(=O)OCC)cnn32)c1=O |
| InChI | InChI=1S/C16H14N4O5/c1-3-11(15(22)23)19-6-5-12-9(14(19)21)7-17-13-10(8-18-20(12)13)16(24)25-4-2/h3,5-8H,4H2,1-2H3,(H,22,23)/b11-3+ |
| InChIKey | NHVNXAXHSWRLEN-QDEBKDIKSA-N |
| XLogP | 1.17 |
| TPSA | 115.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.31 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|