C22H36O6Si — CID 102467595
(R)-[(3aS,4R,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-(4-methoxyphenyl)methanol (PubChem CID 102467595) has the molecular formula C22H36O6Si and a molecular weight of 424.61 g/mol. Its IUPAC name is (R)-[(3aS,4R,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-(4-methoxyphenyl)methanol.
| Compound Name | (R)-[(3aS,4R,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-(4-methoxyphenyl)methanol |
|---|---|
| PubChem CID | 102467595 |
| Molecular Formula | C22H36O6Si |
| Molecular Weight | 424.61 g/mol |
| Exact Mass | 424.23 |
| IUPAC Name | (R)-[(3aS,4R,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-(4-methoxyphenyl)methanol |
| SMILES | COc1ccc([C@@H](O)[C@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@H]3OC(C)(C)O[C@@H]23)cc1 |
| InChI | InChI=1S/C22H36O6Si/c1-21(2,3)29(7,8)25-13-16-18-20(28-22(4,5)27-18)19(26-16)17(23)14-9-11-15(24-6)12-10-14/h9-12,16-20,23H,13H2,1-8H3/t16-,17-,18-,19-,20-/m1/s1 |
| InChIKey | YELGBKGDUSUXDS-LASHMREHSA-N |
| XLogP | 4.04 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.61 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|