(3R)-3-(2,6-dimethoxy-4-pentylphenyl)pent-4-enoic acid

C18H26O4 — CID 102470839

IUPAC(3R)-3-(2,6-dimethoxy-4-pentylphenyl)pent-4-enoic acid
SMILESC=C[C@@H](CC(=O)O)c1c(OC)cc(CCCCC)cc1OC
InChIInChI=1S/C18H26O4/c1-5-7-8-9-13-10-15(21-3)18(16(11-13)22-4)14(6-2)12-17(19)20/h6,10-11,14H,2,5,7-9,12H2,1,3-4H3,(H,19,20)/t14-/m0/s1
InChIKeyDJPYSXZGQLBVEL-AWEZNQCLSA-N
MW306.40 g/mol
LogP4.18
Rot. Bonds10

About (3R)-3-(2,6-dimethoxy-4-pentylphenyl)pent-4-enoic acid

(3R)-3-(2,6-dimethoxy-4-pentylphenyl)pent-4-enoic acid (PubChem CID 102470839) has the molecular formula C18H26O4 and a molecular weight of 306.40 g/mol. Its IUPAC name is (3R)-3-(2,6-dimethoxy-4-pentylphenyl)pent-4-enoic acid.

Molecular Properties

Compound Name(3R)-3-(2,6-dimethoxy-4-pentylphenyl)pent-4-enoic acid
PubChem CID102470839
Molecular FormulaC18H26O4
Molecular Weight306.40 g/mol
Exact Mass306.18
IUPAC Name(3R)-3-(2,6-dimethoxy-4-pentylphenyl)pent-4-enoic acid
SMILESC=C[C@@H](CC(=O)O)c1c(OC)cc(CCCCC)cc1OC
InChIInChI=1S/C18H26O4/c1-5-7-8-9-13-10-15(21-3)18(16(11-13)22-4)14(6-2)12-17(19)20/h6,10-11,14H,2,5,7-9,12H2,1,3-4H3,(H,19,20)/t14-/m0/s1
InChIKeyDJPYSXZGQLBVEL-AWEZNQCLSA-N
XLogP4.18
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds10
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500306.40
LogP ≤ 54.18
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze (3R)-3-(2,6-dimethoxy-4-pentylphenyl)pent-4-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3R)-3-(2,6-dimethoxy-4-pentylphenyl)pent-4-enoic acid?
The IUPAC name of (3R)-3-(2,6-dimethoxy-4-pentylphenyl)pent-4-enoic acid (CID 102470839) is (3R)-3-(2,6-dimethoxy-4-pentylphenyl)pent-4-enoic acid.
What is the SMILES notation for (3R)-3-(2,6-dimethoxy-4-pentylphenyl)pent-4-enoic acid?
The canonical SMILES for (3R)-3-(2,6-dimethoxy-4-pentylphenyl)pent-4-enoic acid is C=C[C@@H](CC(=O)O)c1c(OC)cc(CCCCC)cc1OC.
What is the InChIKey of (3R)-3-(2,6-dimethoxy-4-pentylphenyl)pent-4-enoic acid?
The InChIKey is DJPYSXZGQLBVEL-AWEZNQCLSA-N. The full InChI is InChI=1S/C18H26O4/c1-5-7-8-9-13-10-15(21-3)18(16(11-13)22-4)14(6-2)12-17(19)20/h6,10-11,14H,2,5,7-9,12H2,1,3-4H3,(H,19,20)/t14-/m0/s1.
What are the key properties of (3R)-3-(2,6-dimethoxy-4-pentylphenyl)pent-4-enoic acid?
(3R)-3-(2,6-dimethoxy-4-pentylphenyl)pent-4-enoic acid has a molecular weight of 306.40 g/mol, XLogP of 4.18, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-(2,6-dimethoxy-4-pentylphenyl)pent-4-enoic acid is sourced from PubChem (CID 102470839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).