C18H26O4 — CID 102470839
(3R)-3-(2,6-dimethoxy-4-pentylphenyl)pent-4-enoic acid (PubChem CID 102470839) has the molecular formula C18H26O4 and a molecular weight of 306.40 g/mol. Its IUPAC name is (3R)-3-(2,6-dimethoxy-4-pentylphenyl)pent-4-enoic acid.
| Compound Name | (3R)-3-(2,6-dimethoxy-4-pentylphenyl)pent-4-enoic acid |
|---|---|
| PubChem CID | 102470839 |
| Molecular Formula | C18H26O4 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | (3R)-3-(2,6-dimethoxy-4-pentylphenyl)pent-4-enoic acid |
| SMILES | C=C[C@@H](CC(=O)O)c1c(OC)cc(CCCCC)cc1OC |
| InChI | InChI=1S/C18H26O4/c1-5-7-8-9-13-10-15(21-3)18(16(11-13)22-4)14(6-2)12-17(19)20/h6,10-11,14H,2,5,7-9,12H2,1,3-4H3,(H,19,20)/t14-/m0/s1 |
| InChIKey | DJPYSXZGQLBVEL-AWEZNQCLSA-N |
| XLogP | 4.18 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|