C17H29NO — CID 102470877
(3R)-N-cyclohexyl-3,7-dimethyl-2-methylideneoct-6-enamide (PubChem CID 102470877) has the molecular formula C17H29NO and a molecular weight of 263.42 g/mol. Its IUPAC name is (3R)-N-cyclohexyl-3,7-dimethyl-2-methylideneoct-6-enamide.
| Compound Name | (3R)-N-cyclohexyl-3,7-dimethyl-2-methylideneoct-6-enamide |
|---|---|
| PubChem CID | 102470877 |
| Molecular Formula | C17H29NO |
| Molecular Weight | 263.42 g/mol |
| Exact Mass | 263.22 |
| IUPAC Name | (3R)-N-cyclohexyl-3,7-dimethyl-2-methylideneoct-6-enamide |
| SMILES | C=C(C(=O)NC1CCCCC1)[C@H](C)CCC=C(C)C |
| InChI | InChI=1S/C17H29NO/c1-13(2)9-8-10-14(3)15(4)17(19)18-16-11-6-5-7-12-16/h9,14,16H,4-8,10-12H2,1-3H3,(H,18,19)/t14-/m1/s1 |
| InChIKey | QQVFFMKTZSNQIZ-CQSZACIVSA-N |
| XLogP | 4.37 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.42 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|