C13H22FNO — CID 157204878
2-ethyl-N-(2-fluorocyclohex-2-en-1-yl)pentanamide (PubChem CID 157204878) has the molecular formula C13H22FNO and a molecular weight of 227.32 g/mol. Its IUPAC name is 2-ethyl-N-(2-fluorocyclohex-2-en-1-yl)pentanamide.
| Compound Name | 2-ethyl-N-(2-fluorocyclohex-2-en-1-yl)pentanamide |
|---|---|
| PubChem CID | 157204878 |
| Molecular Formula | C13H22FNO |
| Molecular Weight | 227.32 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | 2-ethyl-N-(2-fluorocyclohex-2-en-1-yl)pentanamide |
| SMILES | CCCC(CC)C(=O)NC1CCCC=C1F |
| InChI | InChI=1S/C13H22FNO/c1-3-7-10(4-2)13(16)15-12-9-6-5-8-11(12)14/h8,10,12H,3-7,9H2,1-2H3,(H,15,16) |
| InChIKey | ARFSMBAKMBGJJV-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.32 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |