C11H19FN2O — CID 70858773
4-amino-6-fluoro-N-methyl-N-propylcyclohex-3-ene-1-carboxamide (PubChem CID 70858773) has the molecular formula C11H19FN2O and a molecular weight of 214.28 g/mol. Its IUPAC name is 4-amino-6-fluoro-N-methyl-N-propylcyclohex-3-ene-1-carboxamide.
| Compound Name | 4-amino-6-fluoro-N-methyl-N-propylcyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 70858773 |
| Molecular Formula | C11H19FN2O |
| Molecular Weight | 214.28 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | 4-amino-6-fluoro-N-methyl-N-propylcyclohex-3-ene-1-carboxamide |
| SMILES | CCCN(C)C(=O)C1CC=C(N)CC1F |
| InChI | InChI=1S/C11H19FN2O/c1-3-6-14(2)11(15)9-5-4-8(13)7-10(9)12/h4,9-10H,3,5-7,13H2,1-2H3 |
| InChIKey | MROUFBVTGIUDIX-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.28 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |