C16H25F3N2O — CID 70892520
4-amino-N-methyl-N-[(Z)-5-(trifluoromethyl)hept-3-en-2-yl]cyclohex-3-ene-1-carboxamide (PubChem CID 70892520) has the molecular formula C16H25F3N2O and a molecular weight of 318.38 g/mol. Its IUPAC name is 4-amino-N-methyl-N-[(Z)-5-(trifluoromethyl)hept-3-en-2-yl]cyclohex-3-ene-1-carboxamide.
| Compound Name | 4-amino-N-methyl-N-[(Z)-5-(trifluoromethyl)hept-3-en-2-yl]cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 70892520 |
| Molecular Formula | C16H25F3N2O |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | 4-amino-N-methyl-N-[(Z)-5-(trifluoromethyl)hept-3-en-2-yl]cyclohex-3-ene-1-carboxamide |
| SMILES | CCC(/C=C\C(C)N(C)C(=O)C1CC=C(N)CC1)C(F)(F)F |
| InChI | InChI=1S/C16H25F3N2O/c1-4-13(16(17,18)19)8-5-11(2)21(3)15(22)12-6-9-14(20)10-7-12/h5,8-9,11-13H,4,6-7,10,20H2,1-3H3/b8-5- |
| InChIKey | WMYBQCKOZLASRI-YVMONPNESA-N |
| XLogP | 3.62 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|