C13H21F3N2O — CID 51080879
N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]cyclohex-3-ene-1-carboxamide (PubChem CID 51080879) has the molecular formula C13H21F3N2O and a molecular weight of 278.31 g/mol. Its IUPAC name is N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]cyclohex-3-ene-1-carboxamide.
| Compound Name | N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 51080879 |
| Molecular Formula | C13H21F3N2O |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]cyclohex-3-ene-1-carboxamide |
| SMILES | CN(CCCNC(=O)C1CCC=CC1)CC(F)(F)F |
| InChI | InChI=1S/C13H21F3N2O/c1-18(10-13(14,15)16)9-5-8-17-12(19)11-6-3-2-4-7-11/h2-3,11H,4-10H2,1H3,(H,17,19) |
| InChIKey | FHCITWHAQIJSDO-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 32.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | 316 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|