C15H21F3N2O2 — CID 57180950
(1S,2S)-1-Trifluoroacetamido-2-(4-methyl-piperidino)carbonyl-4-cyclohexene (PubChem CID 57180950) has the molecular formula C15H21F3N2O2 and a molecular weight of 318.33 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(1S,6S)-6-(4-methylpiperidine-1-carbonyl)cyclohex-3-en-1-yl]acetamide.
| Compound Name | (1S,2S)-1-Trifluoroacetamido-2-(4-methyl-piperidino)carbonyl-4-cyclohexene |
|---|---|
| PubChem CID | 57180950 |
| Molecular Formula | C15H21F3N2O2 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 2,2,2-trifluoro-N-[(1S,6S)-6-(4-methylpiperidine-1-carbonyl)cyclohex-3-en-1-yl]acetamide |
| SMILES | CC1CCN(CC1)C(=O)[C@H]2CC=CC[C@@H]2NC(=O)C(F)(F)F |
| InChI | InChI=1S/C15H21F3N2O2/c1-10-6-8-20(9-7-10)13(21)11-4-2-3-5-12(11)19-14(22)15(16,17)18/h2-3,10-12H,4-9H2,1H3,(H,19,22)/t11-,12-/m0/s1 |
| InChIKey | YEAORYOMDOHALZ-RYUDHWBXSA-N |
| XLogP | 3.20 |
| TPSA | 49.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | 454 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|