C14H22F2N2O — CID 130374426
(4E,6Z)-N-(3-amino-2,2-difluoropropyl)-4,8-dimethylnona-4,6,8-trienamide (PubChem CID 130374426) has the molecular formula C14H22F2N2O and a molecular weight of 272.34 g/mol. Its IUPAC name is (4E,6Z)-N-(3-amino-2,2-difluoropropyl)-4,8-dimethylnona-4,6,8-trienamide.
| Compound Name | (4E,6Z)-N-(3-amino-2,2-difluoropropyl)-4,8-dimethylnona-4,6,8-trienamide |
|---|---|
| PubChem CID | 130374426 |
| Molecular Formula | C14H22F2N2O |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | (4E,6Z)-N-(3-amino-2,2-difluoropropyl)-4,8-dimethylnona-4,6,8-trienamide |
| SMILES | C=C(C)/C=C\C=C(/C)CCC(=O)NCC(F)(F)CN |
| InChI | InChI=1S/C14H22F2N2O/c1-11(2)5-4-6-12(3)7-8-13(19)18-10-14(15,16)9-17/h4-6H,1,7-10,17H2,2-3H3,(H,18,19)/b5-4-,12-6+ |
| InChIKey | QMEBDJGFYZKEGC-QENXGIAESA-N |
| XLogP | 2.56 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|