C12H21FN2O — CID 121336103
N-[(5Z,7E)-7-fluoro-9-(methylamino)nona-5,7-dienyl]acetamide (PubChem CID 121336103) has the molecular formula C12H21FN2O and a molecular weight of 228.31 g/mol. Its IUPAC name is N-[(5Z,7E)-7-fluoro-9-(methylamino)nona-5,7-dienyl]acetamide.
| Compound Name | N-[(5Z,7E)-7-fluoro-9-(methylamino)nona-5,7-dienyl]acetamide |
|---|---|
| PubChem CID | 121336103 |
| Molecular Formula | C12H21FN2O |
| Molecular Weight | 228.31 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | N-[(5Z,7E)-7-fluoro-9-(methylamino)nona-5,7-dienyl]acetamide |
| SMILES | CNC/C=C(F)\C=C/CCCCNC(C)=O |
| InChI | InChI=1S/C12H21FN2O/c1-11(16)15-9-6-4-3-5-7-12(13)8-10-14-2/h5,7-8,14H,3-4,6,9-10H2,1-2H3,(H,15,16)/b7-5-,12-8+ |
| InChIKey | PICNMCXWMMDSLL-BAIUDDDUSA-N |
| XLogP | 1.92 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.31 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|