C13H20FNO — CID 70261540
N-[1-(4-fluorocyclohexa-1,3-dien-1-yl)ethyl]pentanamide (PubChem CID 70261540) has the molecular formula C13H20FNO and a molecular weight of 225.31 g/mol. Its IUPAC name is N-[1-(4-fluorocyclohexa-1,3-dien-1-yl)ethyl]pentanamide.
| Compound Name | N-[1-(4-fluorocyclohexa-1,3-dien-1-yl)ethyl]pentanamide |
|---|---|
| PubChem CID | 70261540 |
| Molecular Formula | C13H20FNO |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | N-[1-(4-fluorocyclohexa-1,3-dien-1-yl)ethyl]pentanamide |
| SMILES | CCCCC(=O)NC(C)C1=CC=C(F)CC1 |
| InChI | InChI=1S/C13H20FNO/c1-3-4-5-13(16)15-10(2)11-6-8-12(14)9-7-11/h6,8,10H,3-5,7,9H2,1-2H3,(H,15,16) |
| InChIKey | IJPPCZSXVMUPNV-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |