C16H17NO5 — CID 102474859
methyl 1-(4-methoxy-2,4-dioxobutyl)-1H-isoquinoline-2-carboxylate (PubChem CID 102474859) has the molecular formula C16H17NO5 and a molecular weight of 303.31 g/mol. Its IUPAC name is methyl 1-(4-methoxy-2,4-dioxobutyl)-1H-isoquinoline-2-carboxylate.
| Compound Name | methyl 1-(4-methoxy-2,4-dioxobutyl)-1H-isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 102474859 |
| Molecular Formula | C16H17NO5 |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | methyl 1-(4-methoxy-2,4-dioxobutyl)-1H-isoquinoline-2-carboxylate |
| SMILES | COC(=O)CC(=O)CC1c2ccccc2C=CN1C(=O)OC |
| InChI | InChI=1S/C16H17NO5/c1-21-15(19)10-12(18)9-14-13-6-4-3-5-11(13)7-8-17(14)16(20)22-2/h3-8,14H,9-10H2,1-2H3 |
| InChIKey | GNHKLWQPLYDPMR-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|