C12H18O2 — CID 102475545
(1S,5R,7S)-7-butoxytricyclo[3.3.0.02,8]octan-3-one (PubChem CID 102475545) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is (1S,5R,7S)-7-butoxytricyclo[3.3.0.02,8]octan-3-one.
| Compound Name | (1S,5R,7S)-7-butoxytricyclo[3.3.0.02,8]octan-3-one |
|---|---|
| PubChem CID | 102475545 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | (1S,5R,7S)-7-butoxytricyclo[3.3.0.02,8]octan-3-one |
| SMILES | CCCCOC1C[C@@H]2CC(=O)C3C1[C@@H]32 |
| InChI | InChI=1S/C12H18O2/c1-2-3-4-14-9-6-7-5-8(13)11-10(7)12(9)11/h7,9-12H,2-6H2,1H3/t7-,9?,10+,11?,12?/m0/s1 |
| InChIKey | YSVUGIHFOVFIBF-UFUGPDJQSA-N |
| XLogP | 2.03 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|