C18H25NO4 — CID 102475587
butyl 3-(1-hydroxyethyl)-4-oxo-1-(1-phenylethyl)azetidine-2-carboxylate (PubChem CID 102475587) has the molecular formula C18H25NO4 and a molecular weight of 319.40 g/mol. Its IUPAC name is butyl 3-(1-hydroxyethyl)-4-oxo-1-(1-phenylethyl)azetidine-2-carboxylate.
| Compound Name | butyl 3-(1-hydroxyethyl)-4-oxo-1-(1-phenylethyl)azetidine-2-carboxylate |
|---|---|
| PubChem CID | 102475587 |
| Molecular Formula | C18H25NO4 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | butyl 3-(1-hydroxyethyl)-4-oxo-1-(1-phenylethyl)azetidine-2-carboxylate |
| SMILES | CCCCOC(=O)C1C(C(C)O)C(=O)N1C(C)c1ccccc1 |
| InChI | InChI=1S/C18H25NO4/c1-4-5-11-23-18(22)16-15(13(3)20)17(21)19(16)12(2)14-9-7-6-8-10-14/h6-10,12-13,15-16,20H,4-5,11H2,1-3H3 |
| InChIKey | IJGCZQXGGNVICH-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|