C18H22N2O8 — CID 102475621
ethyl 4-oxo-3-[[(3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]quinolizine-1-carboxylate (PubChem CID 102475621) has the molecular formula C18H22N2O8 and a molecular weight of 394.38 g/mol. Its IUPAC name is ethyl 4-oxo-3-[[(3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]quinolizine-1-carboxylate.
| Compound Name | ethyl 4-oxo-3-[[(3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]quinolizine-1-carboxylate |
|---|---|
| PubChem CID | 102475621 |
| Molecular Formula | C18H22N2O8 |
| Molecular Weight | 394.38 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | ethyl 4-oxo-3-[[(3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]quinolizine-1-carboxylate |
| SMILES | CCOC(=O)c1cc(NC2O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]2O)c(=O)n2ccccc12 |
| InChI | InChI=1S/C18H22N2O8/c1-2-27-18(26)9-7-10(17(25)20-6-4-3-5-11(9)20)19-16-15(24)14(23)13(22)12(8-21)28-16/h3-7,12-16,19,21-24H,2,8H2,1H3/t12-,13-,14+,15+,16?/m1/s1 |
| InChIKey | MWOOQGIFRVOLAM-WHWZVRATSA-N |
| XLogP | -1.31 |
| TPSA | 149.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.38 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |