C25H38O — CID 10247579
(6aR,10aR)-6,6,9-trimethyl-3-[(2R,3S)-3-methyloctan-2-yl]-6a,7,10,10a-tetrahydrobenzo[c]chromene (PubChem CID 10247579) has the molecular formula C25H38O and a molecular weight of 354.58 g/mol. Its IUPAC name is (6aR,10aR)-6,6,9-trimethyl-3-[(2R,3S)-3-methyloctan-2-yl]-6a,7,10,10a-tetrahydrobenzo[c]chromene.
| Compound Name | (6aR,10aR)-6,6,9-trimethyl-3-[(2R,3S)-3-methyloctan-2-yl]-6a,7,10,10a-tetrahydrobenzo[c]chromene |
|---|---|
| PubChem CID | 10247579 |
| Molecular Formula | C25H38O |
| Molecular Weight | 354.58 g/mol |
| Exact Mass | 354.29 |
| IUPAC Name | (6aR,10aR)-6,6,9-trimethyl-3-[(2R,3S)-3-methyloctan-2-yl]-6a,7,10,10a-tetrahydrobenzo[c]chromene |
| SMILES | CCCCC[C@H](C)[C@@H](C)c1ccc2c(c1)OC(C)(C)[C@@H]1CC=C(C)C[C@@H]21 |
| InChI | InChI=1S/C25H38O/c1-7-8-9-10-18(3)19(4)20-12-13-21-22-15-17(2)11-14-23(22)25(5,6)26-24(21)16-20/h11-13,16,18-19,22-23H,7-10,14-15H2,1-6H3/t18-,19+,22-,23+/m0/s1 |
| InChIKey | KFENKXLOZUVTGH-JFSTXAPLSA-N |
| XLogP | 7.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.58 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|