C35H31N3O2 — CID 102476845
8-(4-methoxy-2,6-dimethylphenyl)-2-[4-(4-methoxy-2,6-dimethylphenyl)-2-pyridinyl]-1,10-phenanthroline (PubChem CID 102476845) has the molecular formula C35H31N3O2 and a molecular weight of 525.65 g/mol. Its IUPAC name is 8-(4-methoxy-2,6-dimethylphenyl)-2-[4-(4-methoxy-2,6-dimethylphenyl)-2-pyridinyl]-1,10-phenanthroline.
| Compound Name | 8-(4-methoxy-2,6-dimethylphenyl)-2-[4-(4-methoxy-2,6-dimethylphenyl)-2-pyridinyl]-1,10-phenanthroline |
|---|---|
| PubChem CID | 102476845 |
| Molecular Formula | C35H31N3O2 |
| Molecular Weight | 525.65 g/mol |
| Exact Mass | 525.24 |
| IUPAC Name | 8-(4-methoxy-2,6-dimethylphenyl)-2-[4-(4-methoxy-2,6-dimethylphenyl)-2-pyridinyl]-1,10-phenanthroline |
| SMILES | COc1cc(C)c(-c2ccnc(-c3ccc4ccc5cc(-c6c(C)cc(OC)cc6C)cnc5c4n3)c2)c(C)c1 |
| InChI | InChI=1S/C35H31N3O2/c1-20-13-28(39-5)14-21(2)32(20)25-11-12-36-31(18-25)30-10-9-24-7-8-26-17-27(19-37-34(26)35(24)38-30)33-22(3)15-29(40-6)16-23(33)4/h7-19H,1-6H3 |
| InChIKey | VEYHLGVOHNKYIX-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.65 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|