C15H22O4 — CID 102477400
methyl (1R,5S)-3,5-ditert-butyl-2-oxo-6-oxabicyclo[3.1.0]hex-3-ene-1-carboxylate (PubChem CID 102477400) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is methyl (1R,5S)-3,5-ditert-butyl-2-oxo-6-oxabicyclo[3.1.0]hex-3-ene-1-carboxylate.
| Compound Name | methyl (1R,5S)-3,5-ditert-butyl-2-oxo-6-oxabicyclo[3.1.0]hex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 102477400 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | methyl (1R,5S)-3,5-ditert-butyl-2-oxo-6-oxabicyclo[3.1.0]hex-3-ene-1-carboxylate |
| SMILES | COC(=O)[C@@]12O[C@]1(C(C)(C)C)C=C(C(C)(C)C)C2=O |
| InChI | InChI=1S/C15H22O4/c1-12(2,3)9-8-14(13(4,5)6)15(19-14,10(9)16)11(17)18-7/h8H,1-7H3/t14-,15+/m0/s1 |
| InChIKey | SVOAHVNPSNMMRX-LSDHHAIUSA-N |
| XLogP | 2.27 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|