C25H34O6 — CID 163049745
[3,5,5,9-tetramethyl-6-(2-methylbut-2-enoyloxy)-2-oxo-4a,6,7,9a-tetrahydro-1H-benzo[7]annulen-7-yl] 2,3-dimethyloxirane-2-carboxylate (PubChem CID 163049745) has the molecular formula C25H34O6 and a molecular weight of 430.54 g/mol. Its IUPAC name is [3,5,5,9-tetramethyl-6-(2-methylbut-2-enoyloxy)-2-oxo-4a,6,7,9a-tetrahydro-1H-benzo[7]annulen-7-yl] 2,3-dimethyloxirane-2-carboxylate.
| Compound Name | [3,5,5,9-tetramethyl-6-(2-methylbut-2-enoyloxy)-2-oxo-4a,6,7,9a-tetrahydro-1H-benzo[7]annulen-7-yl] 2,3-dimethyloxirane-2-carboxylate |
|---|---|
| PubChem CID | 163049745 |
| Molecular Formula | C25H34O6 |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | [3,5,5,9-tetramethyl-6-(2-methylbut-2-enoyloxy)-2-oxo-4a,6,7,9a-tetrahydro-1H-benzo[7]annulen-7-yl] 2,3-dimethyloxirane-2-carboxylate |
| SMILES | CC=C(C)C(=O)OC1C(OC(=O)C2(C)OC2C)C=C(C)C2CC(=O)C(C)=CC2C1(C)C |
| InChI | InChI=1S/C25H34O6/c1-9-13(2)22(27)30-21-20(29-23(28)25(8)16(5)31-25)11-14(3)17-12-19(26)15(4)10-18(17)24(21,6)7/h9-11,16-18,20-21H,12H2,1-8H3 |
| InChIKey | SBTXOKNDHYECQS-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 82.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|