C22H28N2O4 — CID 102477412
methyl (1R,9R,10S,12R,13E,18R)-13-ethylidene-5-methoxy-8-methyl-15-oxido-8-aza-15-azoniapentacyclo[10.5.1.01,9.02,7.010,15]octadeca-2(7),3,5-triene-18-carboxylate (PubChem CID 102477412) has the molecular formula C22H28N2O4 and a molecular weight of 384.48 g/mol. Its IUPAC name is methyl (1R,9R,10S,12R,13E,18R)-13-ethylidene-5-methoxy-8-methyl-15-oxido-8-aza-15-azoniapentacyclo[10.5.1.01,9.02,7.010,15]octadeca-2(7),3,5-triene-18-carboxylate.
| Compound Name | methyl (1R,9R,10S,12R,13E,18R)-13-ethylidene-5-methoxy-8-methyl-15-oxido-8-aza-15-azoniapentacyclo[10.5.1.01,9.02,7.010,15]octadeca-2(7),3,5-triene-18-carboxylate |
|---|---|
| PubChem CID | 102477412 |
| Molecular Formula | C22H28N2O4 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | methyl (1R,9R,10S,12R,13E,18R)-13-ethylidene-5-methoxy-8-methyl-15-oxido-8-aza-15-azoniapentacyclo[10.5.1.01,9.02,7.010,15]octadeca-2(7),3,5-triene-18-carboxylate |
| SMILES | C/C=C1/C[N+]2([O-])CC[C@@]34c5ccc(OC)cc5N(C)[C@H]3[C@@H]2C[C@@H]1[C@H]4C(=O)OC |
| InChI | InChI=1S/C22H28N2O4/c1-5-13-12-24(26)9-8-22-16-7-6-14(27-3)10-17(16)23(2)20(22)18(24)11-15(13)19(22)21(25)28-4/h5-7,10,15,18-20H,8-9,11-12H2,1-4H3/b13-5-/t15-,18-,19-,20-,22-,24?/m0/s1 |
| InChIKey | BFJPLEYDDJAMHY-SFXJXQFTSA-N |
| XLogP | 2.61 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|