C21H26N2O2 — CID 162999296
(1R,9R,10S,12R,16S,17S,18S)-13-ethylidene-4-methoxy-8-methyl-8,15-diazahexacyclo[14.2.1.01,9.02,7.010,15.012,17]nonadeca-2(7),3,5-trien-18-ol (PubChem CID 162999296) has the molecular formula C21H26N2O2 and a molecular weight of 338.45 g/mol. Its IUPAC name is (1R,9R,10S,12R,16S,17S,18S)-13-ethylidene-4-methoxy-8-methyl-8,15-diazahexacyclo[14.2.1.01,9.02,7.010,15.012,17]nonadeca-2(7),3,5-trien-18-ol.
| Compound Name | (1R,9R,10S,12R,16S,17S,18S)-13-ethylidene-4-methoxy-8-methyl-8,15-diazahexacyclo[14.2.1.01,9.02,7.010,15.012,17]nonadeca-2(7),3,5-trien-18-ol |
|---|---|
| PubChem CID | 162999296 |
| Molecular Formula | C21H26N2O2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | (1R,9R,10S,12R,16S,17S,18S)-13-ethylidene-4-methoxy-8-methyl-8,15-diazahexacyclo[14.2.1.01,9.02,7.010,15.012,17]nonadeca-2(7),3,5-trien-18-ol |
| SMILES | CC=C1CN2[C@H]3C[C@@]45c6cc(OC)ccc6N(C)[C@H]4[C@@H]2C[C@@H]1[C@@H]3[C@@H]5O |
| InChI | InChI=1S/C21H26N2O2/c1-4-11-10-23-16-8-13(11)18-17(23)9-21(20(18)24)14-7-12(25-3)5-6-15(14)22(2)19(16)21/h4-7,13,16-20,24H,8-10H2,1-3H3/t13-,16-,17-,18-,19-,20-,21+/m0/s1 |
| InChIKey | QFJCZEAKZSDBCK-IJTPNBLQSA-N |
| XLogP | 2.16 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|