C17H26N2O2Si — CID 23624352
(1S,3aS,8bS)-7-methoxy-3,4,8b-trimethyl-1-trimethylsilyl-1,3a-dihydropyrrolo[2,3-b]indol-2-one (PubChem CID 23624352) has the molecular formula C17H26N2O2Si and a molecular weight of 318.49 g/mol. Its IUPAC name is (1S,3aS,8bS)-7-methoxy-3,4,8b-trimethyl-1-trimethylsilyl-1,3a-dihydropyrrolo[2,3-b]indol-2-one.
| Compound Name | (1S,3aS,8bS)-7-methoxy-3,4,8b-trimethyl-1-trimethylsilyl-1,3a-dihydropyrrolo[2,3-b]indol-2-one |
|---|---|
| PubChem CID | 23624352 |
| Molecular Formula | C17H26N2O2Si |
| Molecular Weight | 318.49 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | (1S,3aS,8bS)-7-methoxy-3,4,8b-trimethyl-1-trimethylsilyl-1,3a-dihydropyrrolo[2,3-b]indol-2-one |
| SMILES | COc1ccc2c(c1)[C@@]1(C)[C@H](N(C)C(=O)[C@H]1[Si](C)(C)C)N2C |
| InChI | InChI=1S/C17H26N2O2Si/c1-17-12-10-11(21-4)8-9-13(12)18(2)16(17)19(3)15(20)14(17)22(5,6)7/h8-10,14,16H,1-7H3/t14-,16+,17-/m1/s1 |
| InChIKey | TXFCUFITGGKDQQ-HYVNUMGLSA-N |
| XLogP | 2.91 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.49 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|