C16H22N2O — CID 67704190
(8bS)-7-methoxy-4,8b-dimethyl-3-prop-2-enyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indole (PubChem CID 67704190) has the molecular formula C16H22N2O and a molecular weight of 258.36 g/mol. Its IUPAC name is (8bS)-7-methoxy-4,8b-dimethyl-3-prop-2-enyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indole.
| Compound Name | (8bS)-7-methoxy-4,8b-dimethyl-3-prop-2-enyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indole |
|---|---|
| PubChem CID | 67704190 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | (8bS)-7-methoxy-4,8b-dimethyl-3-prop-2-enyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indole |
| SMILES | C=CCN1CC[C@@]2(C)c3cc(OC)ccc3N(C)C12 |
| InChI | InChI=1S/C16H22N2O/c1-5-9-18-10-8-16(2)13-11-12(19-4)6-7-14(13)17(3)15(16)18/h5-7,11,15H,1,8-10H2,2-4H3/t15?,16-/m0/s1 |
| InChIKey | MLTQFFZYIMBSFQ-LYKKTTPLSA-N |
| XLogP | 2.62 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|