C21H24N2O3 — CID 67795464
[(8bS)-3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-7-yl] (3-methylphenyl) carbonate (PubChem CID 67795464) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is [(8bS)-3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-7-yl] (3-methylphenyl) carbonate.
| Compound Name | [(8bS)-3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-7-yl] (3-methylphenyl) carbonate |
|---|---|
| PubChem CID | 67795464 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | [(8bS)-3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-7-yl] (3-methylphenyl) carbonate |
| SMILES | Cc1cccc(OC(=O)Oc2ccc3c(c2)[C@]2(C)CCN(C)C2N3C)c1 |
| InChI | InChI=1S/C21H24N2O3/c1-14-6-5-7-15(12-14)25-20(24)26-16-8-9-18-17(13-16)21(2)10-11-22(3)19(21)23(18)4/h5-9,12-13,19H,10-11H2,1-4H3/t19?,21-/m0/s1 |
| InChIKey | NVJTUFNZUWEIIF-QWAKEFERSA-N |
| XLogP | 3.94 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|