C19H19NO3 — CID 102477862
3-oxo-2-(oxolan-2-yl)-N,3-diphenylpropanamide (PubChem CID 102477862) has the molecular formula C19H19NO3 and a molecular weight of 309.37 g/mol. Its IUPAC name is 3-oxo-2-(oxolan-2-yl)-N,3-diphenylpropanamide.
| Compound Name | 3-oxo-2-(oxolan-2-yl)-N,3-diphenylpropanamide |
|---|---|
| PubChem CID | 102477862 |
| Molecular Formula | C19H19NO3 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | 3-oxo-2-(oxolan-2-yl)-N,3-diphenylpropanamide |
| SMILES | O=C(Nc1ccccc1)C(C(=O)c1ccccc1)C1CCCO1 |
| InChI | InChI=1S/C19H19NO3/c21-18(14-8-3-1-4-9-14)17(16-12-7-13-23-16)19(22)20-15-10-5-2-6-11-15/h1-6,8-11,16-17H,7,12-13H2,(H,20,22) |
| InChIKey | KCLGPUZDYOIRCJ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|