C28H49NO4 — CID 102478054
(4R)-4-[(3R,5R,8R,9S,10S,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N-[2-(2-hydroxyethoxy)ethyl]pentanamide (PubChem CID 102478054) has the molecular formula C28H49NO4 and a molecular weight of 463.70 g/mol. Its IUPAC name is (4R)-4-[(3R,5R,8R,9S,10S,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N-[2-(2-hydroxyethoxy)ethyl]pentanamide.
| Compound Name | (4R)-4-[(3R,5R,8R,9S,10S,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N-[2-(2-hydroxyethoxy)ethyl]pentanamide |
|---|---|
| PubChem CID | 102478054 |
| Molecular Formula | C28H49NO4 |
| Molecular Weight | 463.70 g/mol |
| Exact Mass | 463.37 |
| IUPAC Name | (4R)-4-[(3R,5R,8R,9S,10S,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N-[2-(2-hydroxyethoxy)ethyl]pentanamide |
| SMILES | C[C@H](CCC(=O)NCCOCCO)[C@H]1CC[C@H]2[C@@H]3CC[C@@H]4C[C@H](O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C28H49NO4/c1-19(4-9-26(32)29-14-16-33-17-15-30)23-7-8-24-22-6-5-20-18-21(31)10-12-27(20,2)25(22)11-13-28(23,24)3/h19-25,30-31H,4-18H2,1-3H3,(H,29,32)/t19-,20-,21-,22+,23-,24+,25+,27+,28-/m1/s1 |
| InChIKey | ZQLJPZLVMDGKJK-WQKHHYSQSA-N |
| XLogP | 4.55 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.70 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|