C22H30O4 — CID 10247836
[(1S,3S,4R,9R,10S,13S)-5,5,9-trimethyl-14-methylidene-11,15-dioxo-3-tetracyclo[11.2.1.01,10.04,9]hexadecanyl] acetate (PubChem CID 10247836) has the molecular formula C22H30O4 and a molecular weight of 358.48 g/mol. Its IUPAC name is [(1S,3S,4R,9R,10S,13S)-5,5,9-trimethyl-14-methylidene-11,15-dioxo-3-tetracyclo[11.2.1.01,10.04,9]hexadecanyl] acetate.
| Compound Name | [(1S,3S,4R,9R,10S,13S)-5,5,9-trimethyl-14-methylidene-11,15-dioxo-3-tetracyclo[11.2.1.01,10.04,9]hexadecanyl] acetate |
|---|---|
| PubChem CID | 10247836 |
| Molecular Formula | C22H30O4 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | [(1S,3S,4R,9R,10S,13S)-5,5,9-trimethyl-14-methylidene-11,15-dioxo-3-tetracyclo[11.2.1.01,10.04,9]hexadecanyl] acetate |
| SMILES | C=C1C(=O)[C@]23C[C@H]1CC(=O)[C@H]2[C@]1(C)CCCC(C)(C)[C@H]1[C@@H](OC(C)=O)C3 |
| InChI | InChI=1S/C22H30O4/c1-12-14-9-15(24)17-21(5)8-6-7-20(3,4)18(21)16(26-13(2)23)11-22(17,10-14)19(12)25/h14,16-18H,1,6-11H2,2-5H3/t14-,16+,17+,18-,21+,22+/m1/s1 |
| InChIKey | FAFVHJKRCNMFQG-JPGCNHDSSA-N |
| XLogP | 3.88 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|