C27H40O4 — CID 163114105
[(4R,4aS,4bR,8aS,9S,10aR)-4-hydroxy-4b,8,8,10a-tetramethyl-2-[(1R)-4-methyl-5-oxocyclohex-3-en-1-yl]-4,4a,5,6,7,8a,9,10-octahydro-1H-phenanthren-9-yl] acetate (PubChem CID 163114105) has the molecular formula C27H40O4 and a molecular weight of 428.61 g/mol. Its IUPAC name is [(4R,4aS,4bR,8aS,9S,10aR)-4-hydroxy-4b,8,8,10a-tetramethyl-2-[(1R)-4-methyl-5-oxocyclohex-3-en-1-yl]-4,4a,5,6,7,8a,9,10-octahydro-1H-phenanthren-9-yl] acetate.
| Compound Name | [(4R,4aS,4bR,8aS,9S,10aR)-4-hydroxy-4b,8,8,10a-tetramethyl-2-[(1R)-4-methyl-5-oxocyclohex-3-en-1-yl]-4,4a,5,6,7,8a,9,10-octahydro-1H-phenanthren-9-yl] acetate |
|---|---|
| PubChem CID | 163114105 |
| Molecular Formula | C27H40O4 |
| Molecular Weight | 428.61 g/mol |
| Exact Mass | 428.29 |
| IUPAC Name | [(4R,4aS,4bR,8aS,9S,10aR)-4-hydroxy-4b,8,8,10a-tetramethyl-2-[(1R)-4-methyl-5-oxocyclohex-3-en-1-yl]-4,4a,5,6,7,8a,9,10-octahydro-1H-phenanthren-9-yl] acetate |
| SMILES | CC(=O)O[C@H]1C[C@@]2(C)CC([C@@H]3CC=C(C)C(=O)C3)=C[C@@H](O)[C@@H]2[C@@]2(C)CCCC(C)(C)[C@H]12 |
| InChI | InChI=1S/C27H40O4/c1-16-8-9-18(12-20(16)29)19-13-21(30)23-26(5,14-19)15-22(31-17(2)28)24-25(3,4)10-7-11-27(23,24)6/h8,13,18,21-24,30H,7,9-12,14-15H2,1-6H3/t18-,21-,22+,23+,24+,26-,27-/m1/s1 |
| InChIKey | UQPATSBEEBABDM-ZLNDANPTSA-N |
| XLogP | 5.39 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.61 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|