C24H34O5 — CID 163042812
[(1R,2S,3aS,4R,5Z,9Z,12aS)-4-acetyloxy-3a,6,10-trimethyl-11-oxo-1-prop-1-en-2-yl-1,2,3,4,7,8,12,12a-octahydrocyclopenta[11]annulen-2-yl] acetate (PubChem CID 163042812) has the molecular formula C24H34O5 and a molecular weight of 402.53 g/mol. Its IUPAC name is [(1R,2S,3aS,4R,5Z,9Z,12aS)-4-acetyloxy-3a,6,10-trimethyl-11-oxo-1-prop-1-en-2-yl-1,2,3,4,7,8,12,12a-octahydrocyclopenta[11]annulen-2-yl] acetate.
| Compound Name | [(1R,2S,3aS,4R,5Z,9Z,12aS)-4-acetyloxy-3a,6,10-trimethyl-11-oxo-1-prop-1-en-2-yl-1,2,3,4,7,8,12,12a-octahydrocyclopenta[11]annulen-2-yl] acetate |
|---|---|
| PubChem CID | 163042812 |
| Molecular Formula | C24H34O5 |
| Molecular Weight | 402.53 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | [(1R,2S,3aS,4R,5Z,9Z,12aS)-4-acetyloxy-3a,6,10-trimethyl-11-oxo-1-prop-1-en-2-yl-1,2,3,4,7,8,12,12a-octahydrocyclopenta[11]annulen-2-yl] acetate |
| SMILES | C=C(C)[C@@H]1[C@@H](OC(C)=O)C[C@]2(C)[C@H](OC(C)=O)/C=C(/C)CC/C=C(/C)C(=O)C[C@@H]12 |
| InChI | InChI=1S/C24H34O5/c1-14(2)23-19-12-20(27)16(4)10-8-9-15(3)11-22(29-18(6)26)24(19,7)13-21(23)28-17(5)25/h10-11,19,21-23H,1,8-9,12-13H2,2-7H3/b15-11-,16-10-/t19-,21-,22+,23-,24-/m0/s1 |
| InChIKey | DAZXNYZIFCXZQR-QCZKUKJQSA-N |
| XLogP | 4.71 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.53 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|