C22H34O2 — CID 102497675
[(1R,4aS,4bR,8aS,9R,10aS)-2-ethenyl-1,4b,8,8-tetramethyl-1,4,4a,5,6,7,8a,9,10,10a-decahydrophenanthren-9-yl] acetate (PubChem CID 102497675) has the molecular formula C22H34O2 and a molecular weight of 330.51 g/mol. Its IUPAC name is [(1R,4aS,4bR,8aS,9R,10aS)-2-ethenyl-1,4b,8,8-tetramethyl-1,4,4a,5,6,7,8a,9,10,10a-decahydrophenanthren-9-yl] acetate.
| Compound Name | [(1R,4aS,4bR,8aS,9R,10aS)-2-ethenyl-1,4b,8,8-tetramethyl-1,4,4a,5,6,7,8a,9,10,10a-decahydrophenanthren-9-yl] acetate |
|---|---|
| PubChem CID | 102497675 |
| Molecular Formula | C22H34O2 |
| Molecular Weight | 330.51 g/mol |
| Exact Mass | 330.26 |
| IUPAC Name | [(1R,4aS,4bR,8aS,9R,10aS)-2-ethenyl-1,4b,8,8-tetramethyl-1,4,4a,5,6,7,8a,9,10,10a-decahydrophenanthren-9-yl] acetate |
| SMILES | C=CC1=CC[C@H]2[C@@H](C[C@@H](OC(C)=O)[C@H]3C(C)(C)CCC[C@]23C)[C@H]1C |
| InChI | InChI=1S/C22H34O2/c1-7-16-9-10-18-17(14(16)2)13-19(24-15(3)23)20-21(4,5)11-8-12-22(18,20)6/h7,9,14,17-20H,1,8,10-13H2,2-6H3/t14-,17-,18-,19+,20-,22+/m0/s1 |
| InChIKey | HYHIOWBLMCOLTB-QBUJOIIVSA-N |
| XLogP | 5.54 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.51 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |