C24H36O4 — CID 10971135
[(1R,4aR,4bS,8aR,10R)-10-acetyloxy-7-ethenyl-1,4a,8-trimethyl-2,3,4,4b,5,6,8a,9,10,10a-decahydrophenanthren-1-yl]methyl acetate (PubChem CID 10971135) has the molecular formula C24H36O4 and a molecular weight of 388.55 g/mol. Its IUPAC name is [(1R,4aR,4bS,8aR,10R)-10-acetyloxy-7-ethenyl-1,4a,8-trimethyl-2,3,4,4b,5,6,8a,9,10,10a-decahydrophenanthren-1-yl]methyl acetate.
| Compound Name | [(1R,4aR,4bS,8aR,10R)-10-acetyloxy-7-ethenyl-1,4a,8-trimethyl-2,3,4,4b,5,6,8a,9,10,10a-decahydrophenanthren-1-yl]methyl acetate |
|---|---|
| PubChem CID | 10971135 |
| Molecular Formula | C24H36O4 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | [(1R,4aR,4bS,8aR,10R)-10-acetyloxy-7-ethenyl-1,4a,8-trimethyl-2,3,4,4b,5,6,8a,9,10,10a-decahydrophenanthren-1-yl]methyl acetate |
| SMILES | C=CC1=C(C)[C@@H]2CC(OC(C)=O)C3[C@](C)(COC(C)=O)CCC[C@]3(C)[C@H]2CC1 |
| InChI | InChI=1S/C24H36O4/c1-7-18-9-10-20-19(15(18)2)13-21(28-17(4)26)22-23(5,14-27-16(3)25)11-8-12-24(20,22)6/h7,19-22H,1,8-14H2,2-6H3/t19-,20-,21?,22?,23-,24+/m0/s1 |
| InChIKey | SNAWFDHPTJMVKB-BVSHIHRJSA-N |
| XLogP | 5.23 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |