C25H38O5 — CID 162946219
(1S,2R,4aR,4bS,8aS,10R,10aR)-7-ethenyl-10-hydroxy-1,4a,8-trimethyl-2-(3-methylbutanoyloxy)-2,3,4,4b,5,6,8a,9,10,10a-decahydrophenanthrene-1-carboxylic acid (PubChem CID 162946219) has the molecular formula C25H38O5 and a molecular weight of 418.57 g/mol. Its IUPAC name is (1S,2R,4aR,4bS,8aS,10R,10aR)-7-ethenyl-10-hydroxy-1,4a,8-trimethyl-2-(3-methylbutanoyloxy)-2,3,4,4b,5,6,8a,9,10,10a-decahydrophenanthrene-1-carboxylic acid.
| Compound Name | (1S,2R,4aR,4bS,8aS,10R,10aR)-7-ethenyl-10-hydroxy-1,4a,8-trimethyl-2-(3-methylbutanoyloxy)-2,3,4,4b,5,6,8a,9,10,10a-decahydrophenanthrene-1-carboxylic acid |
|---|---|
| PubChem CID | 162946219 |
| Molecular Formula | C25H38O5 |
| Molecular Weight | 418.57 g/mol |
| Exact Mass | 418.27 |
| IUPAC Name | (1S,2R,4aR,4bS,8aS,10R,10aR)-7-ethenyl-10-hydroxy-1,4a,8-trimethyl-2-(3-methylbutanoyloxy)-2,3,4,4b,5,6,8a,9,10,10a-decahydrophenanthrene-1-carboxylic acid |
| SMILES | C=CC1=C(C)[C@H]2C[C@@H](O)[C@@H]3[C@](C)(CC[C@@H](OC(=O)CC(C)C)[C@@]3(C)C(=O)O)[C@H]2CC1 |
| InChI | InChI=1S/C25H38O5/c1-7-16-8-9-18-17(15(16)4)13-19(26)22-24(18,5)11-10-20(25(22,6)23(28)29)30-21(27)12-14(2)3/h7,14,17-20,22,26H,1,8-13H2,2-6H3,(H,28,29)/t17-,18+,19-,20-,22-,24-,25-/m1/s1 |
| InChIKey | WPAPOTTYBLXJHT-PMLKOSANSA-N |
| XLogP | 4.74 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.57 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |