C35H58O2 — CID 163092048
(4,4,6a,6b,8a,12,14b-heptamethyl-11-methylidene-1,2,3,4a,5,6,6a,7,8,9,10,12,12a,13,14,14a-hexadecahydropicen-3-yl) 3-methylbutanoate (PubChem CID 163092048) has the molecular formula C35H58O2 and a molecular weight of 510.85 g/mol. Its IUPAC name is (4,4,6a,6b,8a,12,14b-heptamethyl-11-methylidene-1,2,3,4a,5,6,6a,7,8,9,10,12,12a,13,14,14a-hexadecahydropicen-3-yl) 3-methylbutanoate.
| Compound Name | (4,4,6a,6b,8a,12,14b-heptamethyl-11-methylidene-1,2,3,4a,5,6,6a,7,8,9,10,12,12a,13,14,14a-hexadecahydropicen-3-yl) 3-methylbutanoate |
|---|---|
| PubChem CID | 163092048 |
| Molecular Formula | C35H58O2 |
| Molecular Weight | 510.85 g/mol |
| Exact Mass | 510.44 |
| IUPAC Name | (4,4,6a,6b,8a,12,14b-heptamethyl-11-methylidene-1,2,3,4a,5,6,6a,7,8,9,10,12,12a,13,14,14a-hexadecahydropicen-3-yl) 3-methylbutanoate |
| SMILES | C=C1CCC2(C)CCC3(C)C(CCC4C5(C)CCC(OC(=O)CC(C)C)C(C)(C)C5CCC43C)C2C1C |
| InChI | InChI=1S/C35H58O2/c1-22(2)21-29(36)37-28-15-17-33(8)26(31(28,5)6)14-18-35(10)27(33)12-11-25-30-24(4)23(3)13-16-32(30,7)19-20-34(25,35)9/h22,24-28,30H,3,11-21H2,1-2,4-10H3 |
| InChIKey | XBNOTSHFQMNVHU-UHFFFAOYSA-N |
| XLogP | 9.62 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.85 |
| LogP ≤ 5 | 9.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|