C37H56O2 — CID 45044133
[(1S,5aR,7aR,13bR)-3a,5a,5b,8,8,11a-hexamethyl-1-propan-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-9-yl] benzoate (PubChem CID 45044133) has the molecular formula C37H56O2 and a molecular weight of 532.85 g/mol. Its IUPAC name is [(1S,5aR,7aR,13bR)-3a,5a,5b,8,8,11a-hexamethyl-1-propan-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-9-yl] benzoate.
| Compound Name | [(1S,5aR,7aR,13bR)-3a,5a,5b,8,8,11a-hexamethyl-1-propan-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-9-yl] benzoate |
|---|---|
| PubChem CID | 45044133 |
| Molecular Formula | C37H56O2 |
| Molecular Weight | 532.85 g/mol |
| Exact Mass | 532.43 |
| IUPAC Name | [(1S,5aR,7aR,13bR)-3a,5a,5b,8,8,11a-hexamethyl-1-propan-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-9-yl] benzoate |
| SMILES | CC(C)[C@@H]1CCC2(C)CC[C@]3(C)C(CCC4C5(C)CCC(OC(=O)c6ccccc6)C(C)(C)[C@@H]5CCC43C)[C@@H]12 |
| InChI | InChI=1S/C37H56O2/c1-24(2)26-16-19-34(5)22-23-36(7)27(31(26)34)14-15-29-35(6)20-18-30(39-32(38)25-12-10-9-11-13-25)33(3,4)28(35)17-21-37(29,36)8/h9-13,24,26-31H,14-23H2,1-8H3/t26-,27?,28-,29?,30?,31+,34?,35?,36+,37?/m0/s1 |
| InChIKey | HKBALRMSUSSBAA-NZCPKTAKSA-N |
| XLogP | 9.97 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.85 |
| LogP ≤ 5 | 9.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |