C37H56O — CID 4565302
10-benzylidene-3a,5a,5b,8,8,11a-hexamethyl-1-propan-2-yl-2,3,4,5,6,7,7a,9,11,11b,12,13,13a,13b-tetradecahydro-1H-cyclopenta[a]chrysen-9-ol (PubChem CID 4565302) has the molecular formula C37H56O and a molecular weight of 516.85 g/mol. Its IUPAC name is 10-benzylidene-3a,5a,5b,8,8,11a-hexamethyl-1-propan-2-yl-2,3,4,5,6,7,7a,9,11,11b,12,13,13a,13b-tetradecahydro-1H-cyclopenta[a]chrysen-9-ol.
| Compound Name | 10-benzylidene-3a,5a,5b,8,8,11a-hexamethyl-1-propan-2-yl-2,3,4,5,6,7,7a,9,11,11b,12,13,13a,13b-tetradecahydro-1H-cyclopenta[a]chrysen-9-ol |
|---|---|
| PubChem CID | 4565302 |
| Molecular Formula | C37H56O |
| Molecular Weight | 516.85 g/mol |
| Exact Mass | 516.43 |
| IUPAC Name | 10-benzylidene-3a,5a,5b,8,8,11a-hexamethyl-1-propan-2-yl-2,3,4,5,6,7,7a,9,11,11b,12,13,13a,13b-tetradecahydro-1H-cyclopenta[a]chrysen-9-ol |
| SMILES | CC(C)C1CCC2(C)CCC3(C)C(CCC4C5(C)CC(=Cc6ccccc6)C(O)C(C)(C)C5CCC43C)C12 |
| InChI | InChI=1S/C37H56O/c1-24(2)27-16-18-34(5)20-21-36(7)28(31(27)34)14-15-30-35(6)23-26(22-25-12-10-9-11-13-25)32(38)33(3,4)29(35)17-19-37(30,36)8/h9-13,22,24,27-32,38H,14-21,23H2,1-8H3 |
| InChIKey | GXXPROWADNKVSY-UHFFFAOYSA-N |
| XLogP | 9.80 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.85 |
| LogP ≤ 5 | 9.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |