C39H56O2 — CID 91233497
[(6aR,6aR,6bR,8aR,12aS,14bR)-4,4,6a,6b,8a,12,14b-heptamethyl-11-methylidene-1,2,3,4a,5,6,6a,7,8,9,10,12,12a,13,14,14a-hexadecahydropicen-3-yl] 3-phenylprop-2-enoate (PubChem CID 91233497) has the molecular formula C39H56O2 and a molecular weight of 556.88 g/mol. Its IUPAC name is [(6aR,6aR,6bR,8aR,12aS,14bR)-4,4,6a,6b,8a,12,14b-heptamethyl-11-methylidene-1,2,3,4a,5,6,6a,7,8,9,10,12,12a,13,14,14a-hexadecahydropicen-3-yl] 3-phenylprop-2-enoate.
| Compound Name | [(6aR,6aR,6bR,8aR,12aS,14bR)-4,4,6a,6b,8a,12,14b-heptamethyl-11-methylidene-1,2,3,4a,5,6,6a,7,8,9,10,12,12a,13,14,14a-hexadecahydropicen-3-yl] 3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 91233497 |
| Molecular Formula | C39H56O2 |
| Molecular Weight | 556.88 g/mol |
| Exact Mass | 556.43 |
| IUPAC Name | [(6aR,6aR,6bR,8aR,12aS,14bR)-4,4,6a,6b,8a,12,14b-heptamethyl-11-methylidene-1,2,3,4a,5,6,6a,7,8,9,10,12,12a,13,14,14a-hexadecahydropicen-3-yl] 3-phenylprop-2-enoate |
| SMILES | C=C1CC[C@]2(C)CC[C@]3(C)[C@H](CCC4[C@@]5(C)CCC(OC(=O)C=Cc6ccccc6)C(C)(C)C5CC[C@]43C)[C@@H]2C1C |
| InChI | InChI=1S/C39H56O2/c1-26-18-21-36(5)24-25-38(7)29(34(36)27(26)2)15-16-31-37(6)22-20-32(35(3,4)30(37)19-23-39(31,38)8)41-33(40)17-14-28-12-10-9-11-13-28/h9-14,17,27,29-32,34H,1,15-16,18-25H2,2-8H3/t27?,29-,30?,31?,32?,34+,36-,37+,38-,39-/m1/s1 |
| InChIKey | XZKITZWKPBZYMM-MXNOLLERSA-N |
| XLogP | 10.29 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.88 |
| LogP ≤ 5 | 10.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|