C39H56O2 — CID 162865983
(4,4,6a,6b,8a,11,11,14b-octamethyl-1,2,3,4a,5,6,6a,7,8,9,10,13,14,14a-tetradecahydropicen-3-yl) 3-phenylprop-2-enoate (PubChem CID 162865983) has the molecular formula C39H56O2 and a molecular weight of 556.88 g/mol. Its IUPAC name is (4,4,6a,6b,8a,11,11,14b-octamethyl-1,2,3,4a,5,6,6a,7,8,9,10,13,14,14a-tetradecahydropicen-3-yl) 3-phenylprop-2-enoate.
| Compound Name | (4,4,6a,6b,8a,11,11,14b-octamethyl-1,2,3,4a,5,6,6a,7,8,9,10,13,14,14a-tetradecahydropicen-3-yl) 3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 162865983 |
| Molecular Formula | C39H56O2 |
| Molecular Weight | 556.88 g/mol |
| Exact Mass | 556.43 |
| IUPAC Name | (4,4,6a,6b,8a,11,11,14b-octamethyl-1,2,3,4a,5,6,6a,7,8,9,10,13,14,14a-tetradecahydropicen-3-yl) 3-phenylprop-2-enoate |
| SMILES | CC1(C)C=C2C3CCC4C5(C)CCC(OC(=O)C=Cc6ccccc6)C(C)(C)C5CCC4(C)C3(C)CCC2(C)CC1 |
| InChI | InChI=1S/C39H56O2/c1-34(2)22-23-36(5)24-25-38(7)28(29(36)26-34)15-16-31-37(6)20-19-32(35(3,4)30(37)18-21-39(31,38)8)41-33(40)17-14-27-12-10-9-11-13-27/h9-14,17,26,28,30-32H,15-16,18-25H2,1-8H3 |
| InChIKey | WWIUVLNRTOHDES-UHFFFAOYSA-N |
| XLogP | 10.43 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.88 |
| LogP ≤ 5 | 10.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|